About 4,6-dimethyl-7,8-dihydropteridine
4,6-dimethyl-7,8-dihydropteridine (PubChem CID 23422324) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 4,6-dimethyl-7,8-dihydropteridine.
Molecular Properties
| Compound Name | 4,6-dimethyl-7,8-dihydropteridine |
| PubChem CID | 23422324 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 4,6-dimethyl-7,8-dihydropteridine |
| SMILES | CC1=Nc2c(C)ncnc2NC1 |
| InChI | InChI=1S/C8H10N4/c1-5-3-9-8-7(12-5)6(2)10-4-11-8/h4H,3H2,1-2H3,(H,9,10,11) |
| InChIKey | PLILKFWTAUQFAD-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dimethyl-7,8-dihydropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-7,8-dihydropteridine?
The IUPAC name of 4,6-dimethyl-7,8-dihydropteridine (CID 23422324) is 4,6-dimethyl-7,8-dihydropteridine.
What is the SMILES notation for 4,6-dimethyl-7,8-dihydropteridine?
The canonical SMILES for 4,6-dimethyl-7,8-dihydropteridine is CC1=Nc2c(C)ncnc2NC1.
What is the InChIKey of 4,6-dimethyl-7,8-dihydropteridine?
The InChIKey is PLILKFWTAUQFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-3-9-8-7(12-5)6(2)10-4-11-8/h4H,3H2,1-2H3,(H,9,10,11).
What are the key properties of 4,6-dimethyl-7,8-dihydropteridine?
4,6-dimethyl-7,8-dihydropteridine has a molecular weight of 162.20 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-7,8-dihydropteridine is sourced from PubChem (CID 23422324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).