C7H10N4 — CID 23422329
4-methyl-5,6,7,8-tetrahydropteridine (PubChem CID 23422329) has the molecular formula C7H10N4 and a molecular weight of 150.19 g/mol. Its IUPAC name is 4-methyl-5,6,7,8-tetrahydropteridine.
| Compound Name | 4-methyl-5,6,7,8-tetrahydropteridine |
|---|---|
| PubChem CID | 23422329 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.19 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 4-methyl-5,6,7,8-tetrahydropteridine |
| SMILES | Cc1ncnc2c1NCCN2 |
| InChI | InChI=1S/C7H10N4/c1-5-6-7(11-4-10-5)9-3-2-8-6/h4,8H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | NAJUDRRVPFDWRJ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.19 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |