About 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde
4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde (PubChem CID 23422330) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde |
| PubChem CID | 23422330 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde |
| SMILES | Cc1ncnc2c1N(C=O)CCN2 |
| InChI | InChI=1S/C8H10N4O/c1-6-7-8(11-4-10-6)9-2-3-12(7)5-13/h4-5H,2-3H2,1H3,(H,9,10,11) |
| InChIKey | MNTJNZWUFABNDE-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde?
The IUPAC name of 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde (CID 23422330) is 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde.
What is the SMILES notation for 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde?
The canonical SMILES for 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde is Cc1ncnc2c1N(C=O)CCN2.
What is the InChIKey of 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde?
The InChIKey is MNTJNZWUFABNDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-6-7-8(11-4-10-6)9-2-3-12(7)5-13/h4-5H,2-3H2,1H3,(H,9,10,11).
What are the key properties of 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde?
4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde has a molecular weight of 178.19 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-7,8-dihydro-6H-pteridine-5-carbaldehyde is sourced from PubChem (CID 23422330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).