About 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine
2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine (PubChem CID 23422335) has the molecular formula C9H13ClN4
and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine.
Molecular Properties
| Compound Name | 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine |
| PubChem CID | 23422335 |
| Molecular Formula | C9H13ClN4 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine |
| SMILES | CCN1CCNc2c(C)nc(Cl)nc21 |
| InChI | InChI=1S/C9H13ClN4/c1-3-14-5-4-11-7-6(2)12-9(10)13-8(7)14/h11H,3-5H2,1-2H3 |
| InChIKey | PITFRAJPMICVRD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine?
The IUPAC name of 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine (CID 23422335) is 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine.
What is the SMILES notation for 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine?
The canonical SMILES for 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine is CCN1CCNc2c(C)nc(Cl)nc21.
What is the InChIKey of 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine?
The InChIKey is PITFRAJPMICVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN4/c1-3-14-5-4-11-7-6(2)12-9(10)13-8(7)14/h11H,3-5H2,1-2H3.
What are the key properties of 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine?
2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine has a molecular weight of 212.68 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-8-ethyl-4-methyl-6,7-dihydro-5H-pteridine is sourced from PubChem (CID 23422335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).