C14H20N4O4 — CID 23422440
2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)-N-methylpropanamide (PubChem CID 23422440) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)-N-methylpropanamide.
| Compound Name | 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 23422440 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)-N-methylpropanamide |
| SMILES | CNC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)CN |
| InChI | InChI=1S/C14H20N4O4/c1-16-14(22)11(6-9-2-4-10(19)5-3-9)18-13(21)8-17-12(20)7-15/h2-5,11,19H,6-8,15H2,1H3,(H,16,22)(H,17,20)(H,18,21) |
| InChIKey | CVWZEFMBJWWRNT-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |