C18H26N4O3 — CID 23422502
6-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione (PubChem CID 23422502) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione.
| Compound Name | 6-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione |
|---|---|
| PubChem CID | 23422502 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 6-(2-phenylethyl)-1,4,8,11-tetrazacyclotetradecane-5,7,12-trione |
| SMILES | O=C1CCNCCNC(=O)C(CCc2ccccc2)C(=O)NCCN1 |
| InChI | InChI=1S/C18H26N4O3/c23-16-8-9-19-10-11-21-17(24)15(18(25)22-13-12-20-16)7-6-14-4-2-1-3-5-14/h1-5,15,19H,6-13H2,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | BHWHDRWSBMRQLF-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|