About 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol
4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol (PubChem CID 23422600) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol.
Molecular Properties
| Compound Name | 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol |
| PubChem CID | 23422600 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol |
| SMILES | Cc1nc(C)c(CO)c(CO)c1O |
| InChI | InChI=1S/C9H13NO3/c1-5-7(3-11)8(4-12)9(13)6(2)10-5/h11-13H,3-4H2,1-2H3 |
| InChIKey | IGYIRAOGXMDGQT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol?
The IUPAC name of 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol (CID 23422600) is 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol.
What is the SMILES notation for 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol?
The canonical SMILES for 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol is Cc1nc(C)c(CO)c(CO)c1O.
What is the InChIKey of 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol?
The InChIKey is IGYIRAOGXMDGQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-5-7(3-11)8(4-12)9(13)6(2)10-5/h11-13H,3-4H2,1-2H3.
What are the key properties of 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol?
4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol has a molecular weight of 183.21 g/mol, XLogP of 0.39, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hydroxymethyl)-2,6-dimethylpyridin-3-ol is sourced from PubChem (CID 23422600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).