About 3,3-dipropylpentanedioic acid
3,3-dipropylpentanedioic acid (PubChem CID 23422718) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3,3-dipropylpentanedioic acid.
Molecular Properties
| Compound Name | 3,3-dipropylpentanedioic acid |
| PubChem CID | 23422718 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3,3-dipropylpentanedioic acid |
| SMILES | CCCC(CCC)(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H20O4/c1-3-5-11(6-4-2,7-9(12)13)8-10(14)15/h3-8H2,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | QGDILUQZCFRJIL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-dipropylpentanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dipropylpentanedioic acid?
The IUPAC name of 3,3-dipropylpentanedioic acid (CID 23422718) is 3,3-dipropylpentanedioic acid.
What is the SMILES notation for 3,3-dipropylpentanedioic acid?
The canonical SMILES for 3,3-dipropylpentanedioic acid is CCCC(CCC)(CC(=O)O)CC(=O)O.
What is the InChIKey of 3,3-dipropylpentanedioic acid?
The InChIKey is QGDILUQZCFRJIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-5-11(6-4-2,7-9(12)13)8-10(14)15/h3-8H2,1-2H3,(H,12,13)(H,14,15).
What are the key properties of 3,3-dipropylpentanedioic acid?
3,3-dipropylpentanedioic acid has a molecular weight of 216.28 g/mol, XLogP of 2.52, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dipropylpentanedioic acid is sourced from PubChem (CID 23422718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).