C6H7N3O4 — CID 23422721
1,3-dimethyl-5-nitroso-1,3-diazinane-2,4,6-trione (PubChem CID 23422721) has the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitroso-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-nitroso-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 23422721 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 1,3-dimethyl-5-nitroso-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(N=O)C(=O)N(C)C1=O |
| InChI | InChI=1S/C6H7N3O4/c1-8-4(10)3(7-13)5(11)9(2)6(8)12/h3H,1-2H3 |
| InChIKey | UENWANUIJQSFKU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 87.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|