C9H11N3O7 — CID 23422763
2-[carboxymethyl-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)amino]acetic acid (PubChem CID 23422763) has the molecular formula C9H11N3O7 and a molecular weight of 273.20 g/mol. Its IUPAC name is 2-[carboxymethyl-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)amino]acetic acid.
| Compound Name | 2-[carboxymethyl-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 23422763 |
| Molecular Formula | C9H11N3O7 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-[carboxymethyl-(1-methyl-2,4,6-trioxo-1,3-diazinan-5-yl)amino]acetic acid |
| SMILES | CN1C(=O)NC(=O)C(N(CC(=O)O)CC(=O)O)C1=O |
| InChI | InChI=1S/C9H11N3O7/c1-11-8(18)6(7(17)10-9(11)19)12(2-4(13)14)3-5(15)16/h6H,2-3H2,1H3,(H,13,14)(H,15,16)(H,10,17,19) |
| InChIKey | ALNVVRQOGVZIEK-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 144.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|