About 4-anilinopyridine-2,6-dicarboxylic acid
4-anilinopyridine-2,6-dicarboxylic acid (PubChem CID 23422805) has the molecular formula C13H10N2O4
and a molecular weight of 258.23 g/mol. Its IUPAC name is 4-anilinopyridine-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-anilinopyridine-2,6-dicarboxylic acid |
| PubChem CID | 23422805 |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 4-anilinopyridine-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Nc2ccccc2)cc(C(=O)O)n1 |
| InChI | InChI=1S/C13H10N2O4/c16-12(17)10-6-9(7-11(15-10)13(18)19)14-8-4-2-1-3-5-8/h1-7H,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | BNOAWQFZFKLSMO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-anilinopyridine-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-anilinopyridine-2,6-dicarboxylic acid?
The IUPAC name of 4-anilinopyridine-2,6-dicarboxylic acid (CID 23422805) is 4-anilinopyridine-2,6-dicarboxylic acid.
What is the SMILES notation for 4-anilinopyridine-2,6-dicarboxylic acid?
The canonical SMILES for 4-anilinopyridine-2,6-dicarboxylic acid is O=C(O)c1cc(Nc2ccccc2)cc(C(=O)O)n1.
What is the InChIKey of 4-anilinopyridine-2,6-dicarboxylic acid?
The InChIKey is BNOAWQFZFKLSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O4/c16-12(17)10-6-9(7-11(15-10)13(18)19)14-8-4-2-1-3-5-8/h1-7H,(H,14,15)(H,16,17)(H,18,19).
What are the key properties of 4-anilinopyridine-2,6-dicarboxylic acid?
4-anilinopyridine-2,6-dicarboxylic acid has a molecular weight of 258.23 g/mol, XLogP of 2.22, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-anilinopyridine-2,6-dicarboxylic acid is sourced from PubChem (CID 23422805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).