About 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one
3-hydroxy-2,4-dimethylcyclobut-2-en-1-one (PubChem CID 23423333) has the molecular formula C6H8O2
and a molecular weight of 112.13 g/mol. Its IUPAC name is 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one |
| PubChem CID | 23423333 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one |
| SMILES | CC1=C(O)C(C)C1=O |
| InChI | InChI=1S/C6H8O2/c1-3-5(7)4(2)6(3)8/h3,7H,1-2H3 |
| InChIKey | ZSADIOZWRMCYNY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one?
The IUPAC name of 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one (CID 23423333) is 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one.
What is the SMILES notation for 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one?
The canonical SMILES for 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one is CC1=C(O)C(C)C1=O.
What is the InChIKey of 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one?
The InChIKey is ZSADIOZWRMCYNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O2/c1-3-5(7)4(2)6(3)8/h3,7H,1-2H3.
What are the key properties of 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one?
3-hydroxy-2,4-dimethylcyclobut-2-en-1-one has a molecular weight of 112.13 g/mol, XLogP of 1.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,4-dimethylcyclobut-2-en-1-one is sourced from PubChem (CID 23423333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).