C12H13ClN4S — CID 23423605
5-(4-chlorophenyl)sulfanyl-6-ethylpyrimidine-2,4-diamine (PubChem CID 23423605) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 5-(4-chlorophenyl)sulfanyl-6-ethylpyrimidine-2,4-diamine.
| Compound Name | 5-(4-chlorophenyl)sulfanyl-6-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 23423605 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 5-(4-chlorophenyl)sulfanyl-6-ethylpyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN4S/c1-2-9-10(11(14)17-12(15)16-9)18-8-5-3-7(13)4-6-8/h3-6H,2H2,1H3,(H4,14,15,16,17) |
| InChIKey | IEQSQIQKKHJVLY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |