About 3-phenylsulfanylaniline
3-phenylsulfanylaniline (PubChem CID 23423642) has the molecular formula C12H11NS
and a molecular weight of 201.29 g/mol. Its IUPAC name is 3-phenylsulfanylaniline.
Molecular Properties
| Compound Name | 3-phenylsulfanylaniline |
| PubChem CID | 23423642 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 3-phenylsulfanylaniline |
| SMILES | Nc1cccc(Sc2ccccc2)c1 |
| InChI | InChI=1S/C12H11NS/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H,13H2 |
| InChIKey | JMYWFKZHEPVSIS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylsulfanylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylsulfanylaniline?
The IUPAC name of 3-phenylsulfanylaniline (CID 23423642) is 3-phenylsulfanylaniline.
What is the SMILES notation for 3-phenylsulfanylaniline?
The canonical SMILES for 3-phenylsulfanylaniline is Nc1cccc(Sc2ccccc2)c1.
What is the InChIKey of 3-phenylsulfanylaniline?
The InChIKey is JMYWFKZHEPVSIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NS/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9H,13H2.
What are the key properties of 3-phenylsulfanylaniline?
3-phenylsulfanylaniline has a molecular weight of 201.29 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylsulfanylaniline is sourced from PubChem (CID 23423642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).