C8H15N — CID 23423764
5-ethyl-2-methyl-1,2,3,6-tetrahydropyridine (PubChem CID 23423764) has the molecular formula C8H15N and a molecular weight of 125.21 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-ethyl-2-methyl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 23423764 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 5-ethyl-2-methyl-1,2,3,6-tetrahydropyridine |
| SMILES | CCC1=CCC(C)NC1 |
| InChI | InChI=1S/C8H15N/c1-3-8-5-4-7(2)9-6-8/h5,7,9H,3-4,6H2,1-2H3 |
| InChIKey | IWXJNURGIZIAHS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|