About 6-methoxy-2,3-dimethylpyridine
6-methoxy-2,3-dimethylpyridine (PubChem CID 23423791) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 6-methoxy-2,3-dimethylpyridine.
Molecular Properties
| Compound Name | 6-methoxy-2,3-dimethylpyridine |
| PubChem CID | 23423791 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 6-methoxy-2,3-dimethylpyridine |
| SMILES | COc1ccc(C)c(C)n1 |
| InChI | InChI=1S/C8H11NO/c1-6-4-5-8(10-3)9-7(6)2/h4-5H,1-3H3 |
| InChIKey | RXVIXYHMKNJSOH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxy-2,3-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-2,3-dimethylpyridine?
The IUPAC name of 6-methoxy-2,3-dimethylpyridine (CID 23423791) is 6-methoxy-2,3-dimethylpyridine.
What is the SMILES notation for 6-methoxy-2,3-dimethylpyridine?
The canonical SMILES for 6-methoxy-2,3-dimethylpyridine is COc1ccc(C)c(C)n1.
What is the InChIKey of 6-methoxy-2,3-dimethylpyridine?
The InChIKey is RXVIXYHMKNJSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-6-4-5-8(10-3)9-7(6)2/h4-5H,1-3H3.
What are the key properties of 6-methoxy-2,3-dimethylpyridine?
6-methoxy-2,3-dimethylpyridine has a molecular weight of 137.18 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-2,3-dimethylpyridine is sourced from PubChem (CID 23423791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).