C6H6Cl2N2 — CID 23423792
3,5-dichloro-N-methylpyridin-2-amine (PubChem CID 23423792) has the molecular formula C6H6Cl2N2 and a molecular weight of 177.03 g/mol. Its IUPAC name is 3,5-dichloro-N-methylpyridin-2-amine.
| Compound Name | 3,5-dichloro-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 23423792 |
| Molecular Formula | C6H6Cl2N2 |
| Molecular Weight | 177.03 g/mol |
| Exact Mass | 175.99 |
| IUPAC Name | 3,5-dichloro-N-methylpyridin-2-amine |
| SMILES | CNc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C6H6Cl2N2/c1-9-6-5(8)2-4(7)3-10-6/h2-3H,1H3,(H,9,10) |
| InChIKey | RZQVKCDLRMMEPT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.03 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |