C7H8N2 — CID 23423820
6,8a-dihydropyrrolo[1,2-a]pyrazine (PubChem CID 23423820) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is 6,8a-dihydropyrrolo[1,2-a]pyrazine.
| Compound Name | 6,8a-dihydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 23423820 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | 6,8a-dihydropyrrolo[1,2-a]pyrazine |
| SMILES | C1=CC2C=NC=CN2C1 |
| InChI | InChI=1S/C7H8N2/c1-2-7-6-8-3-5-9(7)4-1/h1-3,5-7H,4H2 |
| InChIKey | OUPZNPUIAXQNAB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|