methoxyarsonous acid

CH5AsO3 — CID 23424004

IUPACmethoxyarsonous acid
SMILESCO[As](O)O
InChIInChI=1S/CH5AsO3/c1-5-2(3)4/h3-4H,1H3
InChIKeyQJIRWUWLWDAYNJ-UHFFFAOYSA-N
MW139.97 g/mol
LogP-1.40
Rot. Bonds1

About methoxyarsonous acid

methoxyarsonous acid (PubChem CID 23424004) has the molecular formula CH5AsO3 and a molecular weight of 139.97 g/mol. Its IUPAC name is methoxyarsonous acid.

Molecular Properties

Compound Namemethoxyarsonous acid
PubChem CID23424004
Molecular FormulaCH5AsO3
Molecular Weight139.97 g/mol
Exact Mass139.95
IUPAC Namemethoxyarsonous acid
SMILESCO[As](O)O
InChIInChI=1S/CH5AsO3/c1-5-2(3)4/h3-4H,1H3
InChIKeyQJIRWUWLWDAYNJ-UHFFFAOYSA-N
XLogP-1.40
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms5
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500139.97
LogP ≤ 5-1.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze methoxyarsonous acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methoxyarsonous acid?
The IUPAC name of methoxyarsonous acid (CID 23424004) is methoxyarsonous acid.
What is the SMILES notation for methoxyarsonous acid?
The canonical SMILES for methoxyarsonous acid is CO[As](O)O.
What is the InChIKey of methoxyarsonous acid?
The InChIKey is QJIRWUWLWDAYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5AsO3/c1-5-2(3)4/h3-4H,1H3.
What are the key properties of methoxyarsonous acid?
methoxyarsonous acid has a molecular weight of 139.97 g/mol, XLogP of -1.40, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyarsonous acid is sourced from PubChem (CID 23424004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).