About 4-fluoro-2-propylphenol
4-fluoro-2-propylphenol (PubChem CID 23424012) has the molecular formula C9H11FO
and a molecular weight of 154.18 g/mol. Its IUPAC name is 4-fluoro-2-propylphenol.
Molecular Properties
| Compound Name | 4-fluoro-2-propylphenol |
| PubChem CID | 23424012 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 4-fluoro-2-propylphenol |
| SMILES | CCCc1cc(F)ccc1O |
| InChI | InChI=1S/C9H11FO/c1-2-3-7-6-8(10)4-5-9(7)11/h4-6,11H,2-3H2,1H3 |
| InChIKey | BQWYJUVFIXTFHH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-propylphenol?
The IUPAC name of 4-fluoro-2-propylphenol (CID 23424012) is 4-fluoro-2-propylphenol.
What is the SMILES notation for 4-fluoro-2-propylphenol?
The canonical SMILES for 4-fluoro-2-propylphenol is CCCc1cc(F)ccc1O.
What is the InChIKey of 4-fluoro-2-propylphenol?
The InChIKey is BQWYJUVFIXTFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FO/c1-2-3-7-6-8(10)4-5-9(7)11/h4-6,11H,2-3H2,1H3.
What are the key properties of 4-fluoro-2-propylphenol?
4-fluoro-2-propylphenol has a molecular weight of 154.18 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-propylphenol is sourced from PubChem (CID 23424012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).