About 7-chloropteridine
7-chloropteridine (PubChem CID 23424052) has the molecular formula C6H3ClN4
and a molecular weight of 166.57 g/mol. Its IUPAC name is 7-chloropteridine.
Molecular Properties
| Compound Name | 7-chloropteridine |
| PubChem CID | 23424052 |
| Molecular Formula | C6H3ClN4 |
| Molecular Weight | 166.57 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 7-chloropteridine |
| SMILES | Clc1cnc2cncnc2n1 |
| InChI | InChI=1S/C6H3ClN4/c7-5-2-9-4-1-8-3-10-6(4)11-5/h1-3H |
| InChIKey | AANUQVPVSJJCRI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.57 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloropteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloropteridine?
The IUPAC name of 7-chloropteridine (CID 23424052) is 7-chloropteridine.
What is the SMILES notation for 7-chloropteridine?
The canonical SMILES for 7-chloropteridine is Clc1cnc2cncnc2n1.
What is the InChIKey of 7-chloropteridine?
The InChIKey is AANUQVPVSJJCRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN4/c7-5-2-9-4-1-8-3-10-6(4)11-5/h1-3H.
What are the key properties of 7-chloropteridine?
7-chloropteridine has a molecular weight of 166.57 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloropteridine is sourced from PubChem (CID 23424052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).