C4H4Cl8 — CID 23424235
1,1,1,2-tetrachloroethane;1,1,2,2-tetrachloroethane (PubChem CID 23424235) has the molecular formula C4H4Cl8 and a molecular weight of 335.70 g/mol. Its IUPAC name is 1,1,1,2-tetrachloroethane;1,1,2,2-tetrachloroethane.
| Compound Name | 1,1,1,2-tetrachloroethane;1,1,2,2-tetrachloroethane |
|---|---|
| PubChem CID | 23424235 |
| Molecular Formula | C4H4Cl8 |
| Molecular Weight | 335.70 g/mol |
| Exact Mass | 331.78 |
| IUPAC Name | 1,1,1,2-tetrachloroethane;1,1,2,2-tetrachloroethane |
| SMILES | ClC(Cl)C(Cl)Cl.ClCC(Cl)(Cl)Cl |
| InChI | InChI=1S/2C2H2Cl4/c3-1-2(4,5)6;3-1(4)2(5)6/h1H2;1-2H |
| InChIKey | MEKJIUITLNIMMR-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.70 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|