C7H13N5 — CID 23424254
2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine (PubChem CID 23424254) has the molecular formula C7H13N5 and a molecular weight of 167.22 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 23424254 |
| Molecular Formula | C7H13N5 |
| Molecular Weight | 167.22 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | 2-N,2-N-diethyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCN(CC)c1ncnc(N)n1 |
| InChI | InChI=1S/C7H13N5/c1-3-12(4-2)7-10-5-9-6(8)11-7/h5H,3-4H2,1-2H3,(H2,8,9,10,11) |
| InChIKey | VGCRQLSQCHXMIS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |