About 2-chloro-3-methoxybutane
2-chloro-3-methoxybutane (PubChem CID 23424437) has the molecular formula C5H11ClO
and a molecular weight of 122.59 g/mol. Its IUPAC name is 2-chloro-3-methoxybutane.
Molecular Properties
| Compound Name | 2-chloro-3-methoxybutane |
| PubChem CID | 23424437 |
| Molecular Formula | C5H11ClO |
| Molecular Weight | 122.59 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | 2-chloro-3-methoxybutane |
| SMILES | COC(C)C(C)Cl |
| InChI | InChI=1S/C5H11ClO/c1-4(6)5(2)7-3/h4-5H,1-3H3 |
| InChIKey | RBFOFWDEFDASDA-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.59 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methoxybutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methoxybutane?
The IUPAC name of 2-chloro-3-methoxybutane (CID 23424437) is 2-chloro-3-methoxybutane.
What is the SMILES notation for 2-chloro-3-methoxybutane?
The canonical SMILES for 2-chloro-3-methoxybutane is COC(C)C(C)Cl.
What is the InChIKey of 2-chloro-3-methoxybutane?
The InChIKey is RBFOFWDEFDASDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO/c1-4(6)5(2)7-3/h4-5H,1-3H3.
What are the key properties of 2-chloro-3-methoxybutane?
2-chloro-3-methoxybutane has a molecular weight of 122.59 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methoxybutane is sourced from PubChem (CID 23424437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).