C25H34O4 — CID 23424627
3,4a-dimethyl-3-[(4E,6E)-2,4,6-trimethyl-8-phenylocta-4,6-dienyl]-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one (PubChem CID 23424627) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is 3,4a-dimethyl-3-[(4E,6E)-2,4,6-trimethyl-8-phenylocta-4,6-dienyl]-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one.
| Compound Name | 3,4a-dimethyl-3-[(4E,6E)-2,4,6-trimethyl-8-phenylocta-4,6-dienyl]-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
|---|---|
| PubChem CID | 23424627 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 3,4a-dimethyl-3-[(4E,6E)-2,4,6-trimethyl-8-phenylocta-4,6-dienyl]-7,7a-dihydro-4H-furo[3,2-c][1,2]dioxin-6-one |
| SMILES | CC(=C\Cc1ccccc1)/C=C(\C)CC(C)CC1(C)CC2(C)OC(=O)CC2OO1 |
| InChI | InChI=1S/C25H34O4/c1-18(11-12-21-9-7-6-8-10-21)13-19(2)14-20(3)16-24(4)17-25(5)22(28-29-24)15-23(26)27-25/h6-11,13,20,22H,12,14-17H2,1-5H3/b18-11+,19-13+ |
| InChIKey | UYFIHBHPIJKAMI-NWLVNBMCSA-N |
| XLogP | 5.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|