C15H20BrClO3 — CID 23424679
(Z)-1-[(1R,5R,6S,8S)-6-bromo-5-ethyl-4,9-dioxabicyclo[6.1.0]nonan-3-yl]-2-chlorohex-3-en-5-yn-1-ol (PubChem CID 23424679) has the molecular formula C15H20BrClO3 and a molecular weight of 363.68 g/mol. Its IUPAC name is (Z)-1-[(1R,5R,6S,8S)-6-bromo-5-ethyl-4,9-dioxabicyclo[6.1.0]nonan-3-yl]-2-chlorohex-3-en-5-yn-1-ol.
| Compound Name | (Z)-1-[(1R,5R,6S,8S)-6-bromo-5-ethyl-4,9-dioxabicyclo[6.1.0]nonan-3-yl]-2-chlorohex-3-en-5-yn-1-ol |
|---|---|
| PubChem CID | 23424679 |
| Molecular Formula | C15H20BrClO3 |
| Molecular Weight | 363.68 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (Z)-1-[(1R,5R,6S,8S)-6-bromo-5-ethyl-4,9-dioxabicyclo[6.1.0]nonan-3-yl]-2-chlorohex-3-en-5-yn-1-ol |
| SMILES | C#C/C=C\C(Cl)C(O)C1C[C@H]2O[C@H]2C[C@H](Br)[C@@H](CC)O1 |
| InChI | InChI=1S/C15H20BrClO3/c1-3-5-6-10(17)15(18)14-8-13-12(20-13)7-9(16)11(4-2)19-14/h1,5-6,9-15,18H,4,7-8H2,2H3/b6-5-/t9-,10?,11+,12-,13+,14?,15?/m0/s1 |
| InChIKey | LCMJLOAUBZVHDH-BXLIVDHVSA-N |
| XLogP | 2.63 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.68 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|