C30H46O2 — CID 23424758
3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one (PubChem CID 23424758) has the molecular formula C30H46O2 and a molecular weight of 438.70 g/mol. Its IUPAC name is 3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one.
| Compound Name | 3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 23424758 |
| Molecular Formula | C30H46O2 |
| Molecular Weight | 438.70 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 3-[(3E,7E,11E)-4,8,12-trimethyl-14-(2,6,6-trimethylcyclohexen-1-yl)tetradeca-3,7,11-trienyl]-2H-furan-5-one |
| SMILES | CC1=C(CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CCC2=CC(=O)OC2)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H46O2/c1-23(11-7-12-24(2)15-9-17-27-21-29(31)32-22-27)13-8-14-25(3)18-19-28-26(4)16-10-20-30(28,5)6/h11,14-15,21H,7-10,12-13,16-20,22H2,1-6H3/b23-11+,24-15+,25-14+ |
| InChIKey | KXWZPQATWYDKBN-SBNFIDSTSA-N |
| XLogP | 8.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.70 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|