C19H28O4 — CID 23424864
[(1E,3E,6E)-3-(acetyloxymethylidene)-7,11-dimethyldodeca-1,6,10-trienyl] acetate (PubChem CID 23424864) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is [(1E,3E,6E)-3-(acetyloxymethylidene)-7,11-dimethyldodeca-1,6,10-trienyl] acetate.
| Compound Name | [(1E,3E,6E)-3-(acetyloxymethylidene)-7,11-dimethyldodeca-1,6,10-trienyl] acetate |
|---|---|
| PubChem CID | 23424864 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | [(1E,3E,6E)-3-(acetyloxymethylidene)-7,11-dimethyldodeca-1,6,10-trienyl] acetate |
| SMILES | CC(=O)O/C=C/C(=C/OC(C)=O)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C19H28O4/c1-15(2)8-6-9-16(3)10-7-11-19(14-23-18(5)21)12-13-22-17(4)20/h8,10,12-14H,6-7,9,11H2,1-5H3/b13-12+,16-10+,19-14+ |
| InChIKey | LGLHHRCOQKUINX-AUHCMFQASA-N |
| XLogP | 4.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|