About 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide
2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide (PubChem CID 23425144) has the molecular formula C8H7BrClNO3
and a molecular weight of 280.51 g/mol. Its IUPAC name is 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide.
Molecular Properties
| Compound Name | 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide |
| PubChem CID | 23425144 |
| Molecular Formula | C8H7BrClNO3 |
| Molecular Weight | 280.51 g/mol |
| Exact Mass | 278.93 |
| IUPAC Name | 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide |
| SMILES | NC(=O)C[C@]1(O)C=C(Cl)C(=O)C(Br)=C1 |
| InChI | InChI=1S/C8H7BrClNO3/c9-4-1-8(14,3-6(11)12)2-5(10)7(4)13/h1-2,14H,3H2,(H2,11,12)/t8-/m1/s1 |
| InChIKey | WEGHCYCIGZFPLF-MRVPVSSYSA-N |
| XLogP | 0.58 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.51 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide?
The IUPAC name of 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide (CID 23425144) is 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide.
What is the SMILES notation for 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide?
The canonical SMILES for 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide is NC(=O)C[C@]1(O)C=C(Cl)C(=O)C(Br)=C1.
What is the InChIKey of 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide?
The InChIKey is WEGHCYCIGZFPLF-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H7BrClNO3/c9-4-1-8(14,3-6(11)12)2-5(10)7(4)13/h1-2,14H,3H2,(H2,11,12)/t8-/m1/s1.
What are the key properties of 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide?
2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide has a molecular weight of 280.51 g/mol, XLogP of 0.58, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1S)-3-bromo-5-chloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl]acetamide is sourced from PubChem (CID 23425144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).