About 4,7-dibromo-2,3-dichloro-1H-indole
4,7-dibromo-2,3-dichloro-1H-indole (PubChem CID 23425158) has the molecular formula C8H3Br2Cl2N
and a molecular weight of 343.83 g/mol. Its IUPAC name is 4,7-dibromo-2,3-dichloro-1H-indole.
Molecular Properties
| Compound Name | 4,7-dibromo-2,3-dichloro-1H-indole |
| PubChem CID | 23425158 |
| Molecular Formula | C8H3Br2Cl2N |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 340.80 |
| IUPAC Name | 4,7-dibromo-2,3-dichloro-1H-indole |
| SMILES | Clc1[nH]c2c(Br)ccc(Br)c2c1Cl |
| InChI | InChI=1S/C8H3Br2Cl2N/c9-3-1-2-4(10)7-5(3)6(11)8(12)13-7/h1-2,13H |
| InChIKey | MPEKURMZTPLRQE-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4,7-dibromo-2,3-dichloro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibromo-2,3-dichloro-1H-indole?
The IUPAC name of 4,7-dibromo-2,3-dichloro-1H-indole (CID 23425158) is 4,7-dibromo-2,3-dichloro-1H-indole.
What is the SMILES notation for 4,7-dibromo-2,3-dichloro-1H-indole?
The canonical SMILES for 4,7-dibromo-2,3-dichloro-1H-indole is Clc1[nH]c2c(Br)ccc(Br)c2c1Cl.
What is the InChIKey of 4,7-dibromo-2,3-dichloro-1H-indole?
The InChIKey is MPEKURMZTPLRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3Br2Cl2N/c9-3-1-2-4(10)7-5(3)6(11)8(12)13-7/h1-2,13H.
What are the key properties of 4,7-dibromo-2,3-dichloro-1H-indole?
4,7-dibromo-2,3-dichloro-1H-indole has a molecular weight of 343.83 g/mol, XLogP of 5.00, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibromo-2,3-dichloro-1H-indole is sourced from PubChem (CID 23425158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).