C23H33N3O2 — CID 23425201
(1R,2R,4aS,5S,8S)-1,5-diisocyano-8-[(2R,5S)-5-(2-isocyanopropan-2-yl)-2-methyloxolan-2-yl]-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol (PubChem CID 23425201) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is (1R,2R,4aS,5S,8S)-1,5-diisocyano-8-[(2R,5S)-5-(2-isocyanopropan-2-yl)-2-methyloxolan-2-yl]-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol.
| Compound Name | (1R,2R,4aS,5S,8S)-1,5-diisocyano-8-[(2R,5S)-5-(2-isocyanopropan-2-yl)-2-methyloxolan-2-yl]-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 23425201 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | (1R,2R,4aS,5S,8S)-1,5-diisocyano-8-[(2R,5S)-5-(2-isocyanopropan-2-yl)-2-methyloxolan-2-yl]-2,5-dimethyl-1,3,4,4a,6,7,8,8a-octahydronaphthalen-2-ol |
| SMILES | [C-]#[N+]C1C2[C@@H]([C@@]3(C)CC[C@@H](C(C)(C)[N+]#[C-])O3)CC[C@](C)([N+]#[C-])[C@H]2CC[C@@]1(C)O |
| InChI | InChI=1S/C23H33N3O2/c1-20(2,25-7)17-11-14-23(5,28-17)16-9-12-21(3,26-8)15-10-13-22(4,27)19(24-6)18(15)16/h15-19,27H,9-14H2,1-5H3/t15-,16-,17-,18?,19?,21-,22+,23+/m0/s1 |
| InChIKey | WUFZGMUGDGETGF-OWRYNARRSA-N |
| XLogP | 4.78 |
| TPSA | 42.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|