C23H34O5 — CID 23425244
[(1S,3R,3aR,4Z,7aR)-3-acetyloxy-4-ethylidene-5-(1,3,3-trimethylcyclohexyl)-3,3a,7,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate (PubChem CID 23425244) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(1S,3R,3aR,4Z,7aR)-3-acetyloxy-4-ethylidene-5-(1,3,3-trimethylcyclohexyl)-3,3a,7,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate.
| Compound Name | [(1S,3R,3aR,4Z,7aR)-3-acetyloxy-4-ethylidene-5-(1,3,3-trimethylcyclohexyl)-3,3a,7,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate |
|---|---|
| PubChem CID | 23425244 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [(1S,3R,3aR,4Z,7aR)-3-acetyloxy-4-ethylidene-5-(1,3,3-trimethylcyclohexyl)-3,3a,7,7a-tetrahydro-1H-2-benzofuran-1-yl] acetate |
| SMILES | C/C=C1\C(C2(C)CCCC(C)(C)C2)=CC[C@H]2[C@H](OC(C)=O)O[C@H](OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C23H34O5/c1-7-16-18(23(6)12-8-11-22(4,5)13-23)10-9-17-19(16)21(27-15(3)25)28-20(17)26-14(2)24/h7,10,17,19-21H,8-9,11-13H2,1-6H3/b16-7+/t17-,19+,20-,21+,23?/m1/s1 |
| InChIKey | APJJJQRQXHYHMQ-VOGOUGRGSA-N |
| XLogP | 4.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |