C15H21ClO — CID 23425284
(3S,4R,4aR)-3-chloro-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one (PubChem CID 23425284) has the molecular formula C15H21ClO and a molecular weight of 252.78 g/mol. Its IUPAC name is (3S,4R,4aR)-3-chloro-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one.
| Compound Name | (3S,4R,4aR)-3-chloro-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one |
|---|---|
| PubChem CID | 23425284 |
| Molecular Formula | C15H21ClO |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (3S,4R,4aR)-3-chloro-1,4,4a,7-tetramethyl-4,5,8,9-tetrahydro-3H-benzo[7]annulen-2-one |
| SMILES | CC1=CC[C@@]2(C)C(=C(C)C(=O)[C@@H](Cl)[C@@H]2C)CC1 |
| InChI | InChI=1S/C15H21ClO/c1-9-5-6-12-10(2)14(17)13(16)11(3)15(12,4)8-7-9/h7,11,13H,5-6,8H2,1-4H3/t11-,13-,15+/m0/s1 |
| InChIKey | JLPKHJCHSNYJEA-CORIIIEPSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|