C15H21Br — CID 23425342
1-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-4-methylbenzene (PubChem CID 23425342) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 1-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-4-methylbenzene.
| Compound Name | 1-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-4-methylbenzene |
|---|---|
| PubChem CID | 23425342 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 1-[(1S,3R)-3-bromo-1,2,2-trimethylcyclopentyl]-4-methylbenzene |
| SMILES | Cc1ccc([C@]2(C)CC[C@@H](Br)C2(C)C)cc1 |
| InChI | InChI=1S/C15H21Br/c1-11-5-7-12(8-6-11)15(4)10-9-13(16)14(15,2)3/h5-8,13H,9-10H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | KORKIDZADLJCNH-HIFRSBDPSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|