C28H48O4 — CID 23425359
6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-(hydroxymethyl)-2-methylheptane-2,5-diol (PubChem CID 23425359) has the molecular formula C28H48O4 and a molecular weight of 448.69 g/mol. Its IUPAC name is 6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-(hydroxymethyl)-2-methylheptane-2,5-diol.
| Compound Name | 6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-(hydroxymethyl)-2-methylheptane-2,5-diol |
|---|---|
| PubChem CID | 23425359 |
| Molecular Formula | C28H48O4 |
| Molecular Weight | 448.69 g/mol |
| Exact Mass | 448.36 |
| IUPAC Name | 6-(3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl)-3-(hydroxymethyl)-2-methylheptane-2,5-diol |
| SMILES | CC(C(O)CC(CO)C(C)(C)O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C28H48O4/c1-17(25(31)15-19(16-29)26(2,3)32)22-8-9-23-21-7-6-18-14-20(30)10-12-27(18,4)24(21)11-13-28(22,23)5/h6,17,19-25,29-32H,7-16H2,1-5H3 |
| InChIKey | BFMCGCIIJRFLCV-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.69 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|