C23H29N7O8S2 — CID 23425395
2-amino-3-[2,3-bis[[5-(2-amino-2-carboxyethyl)-3-methylimidazol-4-yl]sulfanyl]-4,5-dihydroxyphenyl]propanoic acid (PubChem CID 23425395) has the molecular formula C23H29N7O8S2 and a molecular weight of 595.66 g/mol. Its IUPAC name is 2-amino-3-[2,3-bis[[5-(2-amino-2-carboxyethyl)-3-methylimidazol-4-yl]sulfanyl]-4,5-dihydroxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[2,3-bis[[5-(2-amino-2-carboxyethyl)-3-methylimidazol-4-yl]sulfanyl]-4,5-dihydroxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 23425395 |
| Molecular Formula | C23H29N7O8S2 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | 2-amino-3-[2,3-bis[[5-(2-amino-2-carboxyethyl)-3-methylimidazol-4-yl]sulfanyl]-4,5-dihydroxyphenyl]propanoic acid |
| SMILES | Cn1cnc(CC(N)C(=O)O)c1Sc1c(CC(N)C(=O)O)cc(O)c(O)c1Sc1c(CC(N)C(=O)O)ncn1C |
| InChI | InChI=1S/C23H29N7O8S2/c1-29-7-27-13(5-11(25)22(35)36)19(29)39-17-9(3-10(24)21(33)34)4-15(31)16(32)18(17)40-20-14(28-8-30(20)2)6-12(26)23(37)38/h4,7-8,10-12,31-32H,3,5-6,24-26H2,1-2H3,(H,33,34)(H,35,36)(H,37,38) |
| InChIKey | MIRDGRFYERXKGV-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 266.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|