C20H30O — CID 23425614
(6E,10E,14E)-3,6,10,14-tetramethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan (PubChem CID 23425614) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is (6E,10E,14E)-3,6,10,14-tetramethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan.
| Compound Name | (6E,10E,14E)-3,6,10,14-tetramethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan |
|---|---|
| PubChem CID | 23425614 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | (6E,10E,14E)-3,6,10,14-tetramethyl-2,4,5,8,9,12,13,15a-octahydrocyclotetradeca[b]furan |
| SMILES | CC1=C2CC/C(C)=C/CC/C(C)=C/CC/C(C)=C/C2OC1 |
| InChI | InChI=1S/C20H30O/c1-15-7-5-9-16(2)11-12-19-18(4)14-21-20(19)13-17(3)10-6-8-15/h8-9,13,20H,5-7,10-12,14H2,1-4H3/b15-8+,16-9+,17-13+ |
| InChIKey | REIZGKBBDMCFBK-KQZOUPBZSA-N |
| XLogP | 5.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|