C26H36O9 — CID 23425781
[(1S,2R,3S,4R,7S,8Z,12R,13S,17S)-2-acetyloxy-3,17-dihydroxy-4,9,13,17-tetramethyl-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] butanoate (PubChem CID 23425781) has the molecular formula C26H36O9 and a molecular weight of 492.57 g/mol. Its IUPAC name is [(1S,2R,3S,4R,7S,8Z,12R,13S,17S)-2-acetyloxy-3,17-dihydroxy-4,9,13,17-tetramethyl-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] butanoate.
| Compound Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,17S)-2-acetyloxy-3,17-dihydroxy-4,9,13,17-tetramethyl-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] butanoate |
|---|---|
| PubChem CID | 23425781 |
| Molecular Formula | C26H36O9 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | [(1S,2R,3S,4R,7S,8Z,12R,13S,17S)-2-acetyloxy-3,17-dihydroxy-4,9,13,17-tetramethyl-5,16-dioxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,14-dien-12-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H]1CC/C(C)=C\[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@H](OC(C)=O)[C@@H]2[C@]1(C)C=CC(=O)[C@@]2(C)O |
| InChI | InChI=1S/C26H36O9/c1-7-8-20(29)34-18-10-9-14(2)13-19-26(32,15(3)23(30)35-19)22(33-16(4)27)21-24(18,5)12-11-17(28)25(21,6)31/h11-13,15,18-19,21-22,31-32H,7-10H2,1-6H3/b14-13-/t15-,18+,19-,21+,22+,24+,25+,26-/m0/s1 |
| InChIKey | IHDDPBLOCSHWQL-LOGCDZSWSA-N |
| XLogP | 2.18 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|