C15H20O2 — CID 23425963
(8S)-9,10,13-trimethyl-3-oxatricyclo[7.2.2.02,6]trideca-2(6),4,10-trien-8-ol (PubChem CID 23425963) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (8S)-9,10,13-trimethyl-3-oxatricyclo[7.2.2.02,6]trideca-2(6),4,10-trien-8-ol.
| Compound Name | (8S)-9,10,13-trimethyl-3-oxatricyclo[7.2.2.02,6]trideca-2(6),4,10-trien-8-ol |
|---|---|
| PubChem CID | 23425963 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (8S)-9,10,13-trimethyl-3-oxatricyclo[7.2.2.02,6]trideca-2(6),4,10-trien-8-ol |
| SMILES | CC1=CC2CC(C)C1(C)[C@@H](O)Cc1ccoc12 |
| InChI | InChI=1S/C15H20O2/c1-9-6-12-7-10(2)15(9,3)13(16)8-11-4-5-17-14(11)12/h4-6,10,12-13,16H,7-8H2,1-3H3/t10?,12?,13-,15?/m0/s1 |
| InChIKey | IJVZDWKOTWSBKM-MFHNVLSASA-N |
| XLogP | 3.27 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|