C18H18Br6O4 — CID 23425979
(5R,6R)-1,7,11,11,12,12-hexabromo-2,8-dibutyl-4,10-dioxadispiro[4.0.46.25]dodeca-1,7-diene-3,9-dione (PubChem CID 23425979) has the molecular formula C18H18Br6O4 and a molecular weight of 777.76 g/mol. Its IUPAC name is (5R,6R)-1,7,11,11,12,12-hexabromo-2,8-dibutyl-4,10-dioxadispiro[4.0.46.25]dodeca-1,7-diene-3,9-dione.
| Compound Name | (5R,6R)-1,7,11,11,12,12-hexabromo-2,8-dibutyl-4,10-dioxadispiro[4.0.46.25]dodeca-1,7-diene-3,9-dione |
|---|---|
| PubChem CID | 23425979 |
| Molecular Formula | C18H18Br6O4 |
| Molecular Weight | 777.76 g/mol |
| Exact Mass | 771.63 |
| IUPAC Name | (5R,6R)-1,7,11,11,12,12-hexabromo-2,8-dibutyl-4,10-dioxadispiro[4.0.46.25]dodeca-1,7-diene-3,9-dione |
| SMILES | CCCCC1=C(Br)[C@@]2(OC1=O)C(Br)(Br)C(Br)(Br)[C@@]21OC(=O)C(CCCC)=C1Br |
| InChI | InChI=1S/C18H18Br6O4/c1-3-5-7-9-11(19)15(27-13(9)25)16(18(23,24)17(15,21)22)12(20)10(8-6-4-2)14(26)28-16/h3-8H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | BMGUFFHPUBGKBV-HOTGVXAUSA-N |
| XLogP | 7.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.76 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|