C27H42O10S — CID 23426239
[(6S)-17-acetyl-10,13-dimethyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate (PubChem CID 23426239) has the molecular formula C27H42O10S and a molecular weight of 558.69 g/mol. Its IUPAC name is [(6S)-17-acetyl-10,13-dimethyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate.
| Compound Name | [(6S)-17-acetyl-10,13-dimethyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 23426239 |
| Molecular Formula | C27H42O10S |
| Molecular Weight | 558.69 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | [(6S)-17-acetyl-10,13-dimethyl-6-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,4,5,6,7,8,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] hydrogen sulfate |
| SMILES | CC(=O)C1CCC2C3C[C@H](OC4OC(C)C(O)C(O)C4O)C4CC(OS(=O)(=O)O)CCC4(C)C3=CCC12C |
| InChI | InChI=1S/C27H42O10S/c1-13(28)17-5-6-18-16-12-21(36-25-24(31)23(30)22(29)14(2)35-25)20-11-15(37-38(32,33)34)7-9-27(20,4)19(16)8-10-26(17,18)3/h8,14-18,20-25,29-31H,5-7,9-12H2,1-4H3,(H,32,33,34)/t14?,15?,16?,17?,18?,20?,21-,22?,23?,24?,25?,26?,27?/m0/s1 |
| InChIKey | GUMZZJRMUPNYID-IOLMCPSASA-N |
| XLogP | 2.16 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|