C18H23N — CID 23426268
(6R,8S)-4-[(Z)-but-1-enyl]-5,6,8-trimethyl-1,6,7,8-tetrahydrocyclopenta[g]indole (PubChem CID 23426268) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is (6R,8S)-4-[(Z)-but-1-enyl]-5,6,8-trimethyl-1,6,7,8-tetrahydrocyclopenta[g]indole.
| Compound Name | (6R,8S)-4-[(Z)-but-1-enyl]-5,6,8-trimethyl-1,6,7,8-tetrahydrocyclopenta[g]indole |
|---|---|
| PubChem CID | 23426268 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | (6R,8S)-4-[(Z)-but-1-enyl]-5,6,8-trimethyl-1,6,7,8-tetrahydrocyclopenta[g]indole |
| SMILES | CC/C=C\c1c(C)c2c(c3[nH]ccc13)[C@@H](C)C[C@H]2C |
| InChI | InChI=1S/C18H23N/c1-5-6-7-14-13(4)16-11(2)10-12(3)17(16)18-15(14)8-9-19-18/h6-9,11-12,19H,5,10H2,1-4H3/b7-6-/t11-,12+/m1/s1 |
| InChIKey | YGJOTNUEIJGQSG-PBWNMSGQSA-N |
| XLogP | 5.51 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |