C21H32O4 — CID 23426274
methyl 2-[(3R,4R)-4-[1-[(1R,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-5-oxooxolan-3-yl]acetate (PubChem CID 23426274) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is methyl 2-[(3R,4R)-4-[1-[(1R,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-5-oxooxolan-3-yl]acetate.
| Compound Name | methyl 2-[(3R,4R)-4-[1-[(1R,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-5-oxooxolan-3-yl]acetate |
|---|---|
| PubChem CID | 23426274 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | methyl 2-[(3R,4R)-4-[1-[(1R,7aS)-4,4,7a-trimethyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]ethenyl]-5-oxooxolan-3-yl]acetate |
| SMILES | C=C([C@@H]1C(=O)OC[C@@H]1CC(=O)OC)[C@H]1CCC2C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C21H32O4/c1-13(18-14(11-17(22)24-5)12-25-19(18)23)15-7-8-16-20(2,3)9-6-10-21(15,16)4/h14-16,18H,1,6-12H2,2-5H3/t14-,15+,16?,18-,21+/m0/s1 |
| InChIKey | AUGASOGXBNPTHZ-UEMFNXARSA-N |
| XLogP | 4.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|