About (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial
(2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial (PubChem CID 23426277) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial.
Molecular Properties
| Compound Name | (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial |
| PubChem CID | 23426277 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial |
| SMILES | CC(C)=CC#C/C(C)=C/C/C=C(/C=O)CC=O |
| InChI | InChI=1S/C15H18O2/c1-13(2)6-4-7-14(3)8-5-9-15(12-17)10-11-16/h6,8-9,11-12H,5,10H2,1-3H3/b14-8+,15-9+ |
| InChIKey | QRFWLZGUPBROQW-VOMDNODZSA-N |
| XLogP | 3.01 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial?
The IUPAC name of (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial (CID 23426277) is (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial.
What is the SMILES notation for (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial?
The canonical SMILES for (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial is CC(C)=CC#C/C(C)=C/C/C=C(/C=O)CC=O.
What is the InChIKey of (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial?
The InChIKey is QRFWLZGUPBROQW-VOMDNODZSA-N. The full InChI is InChI=1S/C15H18O2/c1-13(2)6-4-7-14(3)8-5-9-15(12-17)10-11-16/h6,8-9,11-12H,5,10H2,1-3H3/b14-8+,15-9+.
What are the key properties of (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial?
(2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial has a molecular weight of 230.31 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(3E)-4,8-dimethylnona-3,7-dien-5-ynylidene]butanedial is sourced from PubChem (CID 23426277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).