C18H30O2 — CID 23426350
(E)-8-[(1R,5S)-5-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-6-methyloct-5-en-2-one (PubChem CID 23426350) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (E)-8-[(1R,5S)-5-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-6-methyloct-5-en-2-one.
| Compound Name | (E)-8-[(1R,5S)-5-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-6-methyloct-5-en-2-one |
|---|---|
| PubChem CID | 23426350 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (E)-8-[(1R,5S)-5-hydroxy-2,6,6-trimethylcyclohex-2-en-1-yl]-6-methyloct-5-en-2-one |
| SMILES | CC(=O)CC/C=C(\C)CC[C@@H]1C(C)=CC[C@H](O)C1(C)C |
| InChI | InChI=1S/C18H30O2/c1-13(7-6-8-15(3)19)9-11-16-14(2)10-12-17(20)18(16,4)5/h7,10,16-17,20H,6,8-9,11-12H2,1-5H3/b13-7+/t16-,17+/m1/s1 |
| InChIKey | DDVNUHLHDWACFY-NQADVFLWSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|