C18H30O2 — CID 23426356
(5E,9E,13R)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trien-2-one (PubChem CID 23426356) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5E,9E,13R)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trien-2-one.
| Compound Name | (5E,9E,13R)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trien-2-one |
|---|---|
| PubChem CID | 23426356 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (5E,9E,13R)-13-hydroxy-6,10,14-trimethylpentadeca-5,9,14-trien-2-one |
| SMILES | C=C(C)[C@H](O)CC/C(C)=C/CC/C(C)=C/CCC(C)=O |
| InChI | InChI=1S/C18H30O2/c1-14(2)18(20)13-12-16(4)9-6-8-15(3)10-7-11-17(5)19/h9-10,18,20H,1,6-8,11-13H2,2-5H3/b15-10+,16-9+/t18-/m1/s1 |
| InChIKey | KUTNIFBDXANLKK-CUAZYIIYSA-N |
| XLogP | 4.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|