C20H32O2 — CID 23426380
(2R,3R,3aR,6E,10E,11aS)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-oxolane] (PubChem CID 23426380) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (2R,3R,3aR,6E,10E,11aS)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-oxolane].
| Compound Name | (2R,3R,3aR,6E,10E,11aS)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-oxolane] |
|---|---|
| PubChem CID | 23426380 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2R,3R,3aR,6E,10E,11aS)-3,5',5',6,10-pentamethylspiro[3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-2,2'-oxolane] |
| SMILES | C/C1=C\[C@H]2O[C@@]3(CCC(C)(C)O3)[C@H](C)[C@H]2CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32O2/c1-14-7-6-8-15(2)13-18-17(10-9-14)16(3)20(21-18)12-11-19(4,5)22-20/h7,13,16-18H,6,8-12H2,1-5H3/b14-7+,15-13+/t16-,17-,18-,20-/m1/s1 |
| InChIKey | ZPBWPUVXJVFWRQ-QUPPYPRISA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|