C19H30O3 — CID 23426617
(1S,3aR,6R,7Z,7aR)-7-ethylidene-1-hydroxy-6-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-1H-2-benzofuran-5-one (PubChem CID 23426617) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1S,3aR,6R,7Z,7aR)-7-ethylidene-1-hydroxy-6-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-1H-2-benzofuran-5-one.
| Compound Name | (1S,3aR,6R,7Z,7aR)-7-ethylidene-1-hydroxy-6-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-1H-2-benzofuran-5-one |
|---|---|
| PubChem CID | 23426617 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S,3aR,6R,7Z,7aR)-7-ethylidene-1-hydroxy-6-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-1H-2-benzofuran-5-one |
| SMILES | C/C=C1/[C@H]2[C@H](CO[C@@H]2O)CC(=O)[C@@H]1[C@@]1(C)CCCC(C)(C)C1 |
| InChI | InChI=1S/C19H30O3/c1-5-13-15-12(10-22-17(15)21)9-14(20)16(13)19(4)8-6-7-18(2,3)11-19/h5,12,15-17,21H,6-11H2,1-4H3/b13-5-/t12-,15+,16+,17-,19-/m0/s1 |
| InChIKey | RPHDRFPSWHBWIN-BVJOOIOFSA-N |
| XLogP | 3.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|