C14H8Br6O5 — CID 23426771
3,4,6-tribromo-5-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methoxymethyl]benzene-1,2-diol (PubChem CID 23426771) has the molecular formula C14H8Br6O5 and a molecular weight of 735.64 g/mol. Its IUPAC name is 3,4,6-tribromo-5-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methoxymethyl]benzene-1,2-diol.
| Compound Name | 3,4,6-tribromo-5-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methoxymethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 23426771 |
| Molecular Formula | C14H8Br6O5 |
| Molecular Weight | 735.64 g/mol |
| Exact Mass | 729.55 |
| IUPAC Name | 3,4,6-tribromo-5-[(2,3,6-tribromo-4,5-dihydroxyphenyl)methoxymethyl]benzene-1,2-diol |
| SMILES | Oc1c(O)c(Br)c(COCc2c(Br)c(O)c(O)c(Br)c2Br)c(Br)c1Br |
| InChI | InChI=1S/C14H8Br6O5/c15-5-3(7(17)11(21)13(23)9(5)19)1-25-2-4-6(16)10(20)14(24)12(22)8(4)18/h21-24H,1-2H2 |
| InChIKey | BRLKFLGNILMDCZ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|