About 2-chloro-2-iodoacetic acid
2-chloro-2-iodoacetic acid (PubChem CID 23426777) has the molecular formula C2H2ClIO2
and a molecular weight of 220.39 g/mol. Its IUPAC name is 2-chloro-2-iodoacetic acid.
Molecular Properties
| Compound Name | 2-chloro-2-iodoacetic acid |
| PubChem CID | 23426777 |
| Molecular Formula | C2H2ClIO2 |
| Molecular Weight | 220.39 g/mol |
| Exact Mass | 219.88 |
| IUPAC Name | 2-chloro-2-iodoacetic acid |
| SMILES | O=C(O)C(Cl)I |
| InChI | InChI=1S/C2H2ClIO2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | ORHUCRGLFVRTJV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.39 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2-iodoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2-iodoacetic acid?
The IUPAC name of 2-chloro-2-iodoacetic acid (CID 23426777) is 2-chloro-2-iodoacetic acid.
What is the SMILES notation for 2-chloro-2-iodoacetic acid?
The canonical SMILES for 2-chloro-2-iodoacetic acid is O=C(O)C(Cl)I.
What is the InChIKey of 2-chloro-2-iodoacetic acid?
The InChIKey is ORHUCRGLFVRTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2ClIO2/c3-1(4)2(5)6/h1H,(H,5,6).
What are the key properties of 2-chloro-2-iodoacetic acid?
2-chloro-2-iodoacetic acid has a molecular weight of 220.39 g/mol, XLogP of 1.07, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2-iodoacetic acid is sourced from PubChem (CID 23426777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).